BIOPEP-UWM: Report
| ID | 7807 |
| Name | ACE inhibitor from caprine beta-Lg |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 391.5031 | Monoisotopic mass | 391.2463 | |
| IC50 : | 79.80 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernández-Ledesma B., Recio I., Ramos M., Amigo L. | |
| Title | |
| Preparation of ovine and caprine β-lactoglobulin hydrolysates with ACE-inhibitory activity. Identification of active peptides from caprine β-lactoglobulin hydrolysed with thermolysin. Int. Dairy J., 12, 805-812, 2002 | |
| Year | Source |
| 2002 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O InChI=1S/C21H33N3O4/c1-13(2)10-16(22)19(25)23-17(11-14(3)4)20(26)24-18(21(27)28)12-15-8-6-5-7-9-15/h5-9,13-14,16-18H,10-12,22H2,1-4H3,(H,23,25)(H,24,26)(H,27,28)/t16-,17-,18-/m0/s1 InChIKey=UBZGNBKMIJHOHL-BZSNNMDCSA-N Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 500); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1009, 1318, 1549, 1741, 2011, 3980, 4170, 4301, 4327, 4783, 4970, 5230, 5539, 5925, 6710 BIOPEP-UWM database of sensory peptides and amino acids: ID 500 ChEBI: ID 159321 ChemSpider: ID 5731239 EPA DSSTox: ID DTXSID80428627 EROP-Moscow: ID E23520 FeptideDB: ID 7807 J-GLOBAL: ID 200907050689359709 MBPDB: Peptide LLF Nikkaji: ID J492.338C PubChem: CID 7408573 SATPdb: ID satpdb13167 |