BIOPEP-UWM: Report
| ID | 7820 |
| Name | ACE inhibitor from wheat gliadin |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 269.2962 | Monoisotopic mass | 269.1371 | |
| IC50 : | 23.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Murray B.A., FitzGerald R. J. | |
| Title | |
| Angiotensin converting enzyme inhibitory peptides derived from food proteins: biochemistry, bioactivity and production. Curr. Pharm. Des., 2007, 13, 773-791. | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C12H19N3O4/c13-7-10(16)14-5-1-3-8(14)11(17)15-6-2-4-9(15)12(18)19/h8-9H,1-7,13H2,(H,18,19)/t8-,9-/m0/s1 InChIKey=OOCFXNOVSLSHAB-IUCAKERBSA-N Prepared with the use of alkaline extract. Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 8987) |
| Database reference: |
| AHTPDB: ID 1566, 1819, 5684, 6723 BioPepDB: ID biopep00392 BIOPEP-UWM database of bioactive peptides: ID 8987 ChEBI: ID 163975 ChemIDplus: ID 26655-82-3 ChemSpider: ID 2339713 eChemPortal: ID 26655-82-3 EPA CompTox: ID DTXSID60181187 FeptideDB: ID 7820; 8987 PlantPepDB: ID PPepDB_3790 PubChem: CID 3082260 SATPdb: ID satpdb17505 |