BIOPEP-UWM: Report
| ID | 7823 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 349.4236 | Monoisotopic mass | 349.1995 | |
| IC50 : | 26.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K., Chen J. R. | |
| Title | |
| Identification of antihypertensive peptides from peptic digest of two microalgae, Chlorella vulgaris and Spirulina platensis. Marine Biotechnol., 3, 305-309, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C18H27N3O4/c1-11(2)9-15(18(24)25)21-16(22)12(3)20-17(23)14(19)10-13-7-5-4-6-8-13/h4-8,11-12,14-15H,9-10,19H2,1-3H3,(H,20,23)(H,21,22)(H,24,25)/t12-,14-,15-/m0/s1 InChIKey=BBDSZDHUCPSYAC-QEJZJMRPSA-N |
| Database reference: |
| AHTPDB: ID 1032, 1571, 1863, 1867, 3478, 3904, 5100, 6726 BioPepDB: ID biopep00207 ChEBI: ID 161260 EROP-Moscow: ID E07053 FeptideDB: ID 7823 PubChem: CID 145457126 SATPdb: ID satpdb26947 |