BIOPEP-UWM: Report
| ID | 7827 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 260.2861 | Monoisotopic mass | 260.1367 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van Platerink C. J., Janssen H.-G. M., Haverkamp J. | |
| Title | |
| Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal. Bioanal. Chem., 2008, 391, 299-307. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C11H20N2O5/c1-3-6(2)9(12)10(16)13-7(11(17)18)4-5-8(14)15/h6-7,9H,3-5,12H2,1-2H3,(H,13,16)(H,14,15)(H,17,18)/t6-,7-,9-/m0/s1 InChIKey=KTGFOCFYOZQVRJ-ZKWXMUAHSA-N Inhibitor of Glutamate carboxypeptidase (EC 3.4.17.11) (MEROPS ID: M20.001) according to the BRENDA database Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 487); the ChENBL database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 1701, 2987, 3033, 3113, 3280, 3356, 3437, 3867, 3946, 6730 BioPepDB: ID biopep00496 BIOPEP-UWM database of sensory peptides and amino acids: ID 487 BRENDA: Ligand Ile-Glu ChEBI: ID 137259 ChEMBL: ID CHEMBL436551 ChemSpider: ID 5373205 EROP-Moscow: ID E01850 FeptideDB: ID 7827 J-GLOBAL: ID 201407086499305160 Nikkaji: ID J3.318.463H PubChem: CID 7009625 SATPdb: ID satpdb19205 SureChEMBL: ID SCHEMBL12496193 ZINC: ID ZINC000002384845 |