BIOPEP-UWM: Report
| ID | 7830 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (EC 3.4.15.1) (MEROPS ID: XM02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 248.2325 | Monoisotopic mass | 248.1004 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van Platerink C. J., Janssen H.-G. M., Haverkamp J. | |
| Title | |
| Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal. Bioanal. Chem., 2008, 391, 299-307. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@H](C(=O)N[C@H](C(=O)O)CCC(=O)O)[C@H](O)C InChI=1S/C9H16N2O6/c1-4(12)7(10)8(15)11-5(9(16)17)2-3-6(13)14/h4-5,7,12H,2-3,10H2,1H3,(H,11,15)(H,13,14)(H,16,17)/t4-,5+,7+/m1/s1 InChIKey: BECPPKYKPSRKCP-ZDLURKLDSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP database of bioactive peptides (ID 8899) Umami peptide according to the BIOPEP database of sensory peptides and amino acids; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 3030, 3283, 3324, 3440, 3538, 4029, 6733 BIOPEP database of bioactive peptides: ID 8899 BIOPEP database of sensory peptides and amino acids: ID 407 ChEBI: ID 74857 ChemSpider: ID 5383120 EROP-Moscow: ID E01852 PubChem: ID 7020163 SATPdb: ID satpdb11208 ZINC: ID ZINC02561113 |