BIOPEP-UWM: Report
| ID | 7833 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 216.2337 | Monoisotopic mass | 216.1106 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van Platerink C. J., Janssen H.-G. M., Haverkamp J. | |
| Title | |
| Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal. Bioanal. Chem., 2008, 391, 299-307. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C9H16N2O4/c1-5(12)7(9(14)15)11-8(13)6-3-2-4-10-6/h5-7,10,12H,2-4H2,1H3,(H,11,13)(H,14,15)/t5-,6+,7+/m1/s1 InChIKey=GVUVRRPYYDHHGK-VQVTYTSYSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8863) |
| Database reference: |
| AHTPDB: ID 3106, 3286, 3443, 3528, 4013, 6736 BioPepDB: ID biopep01105 BIOPEP-UWM database of bioactive peptides: ID 8863 ChEBI: ID 141395 ChemSpider: ID 50074959 FeptideDB: ID 7833; 8863 PlantPepDB: ID PPepDB_168 PubChem: CID 53860028 SATPdb: ID satpdb28431 |