BIOPEP-UWM: Report
| ID | 7837 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 243.2590 | Monoisotopic mass | 243.1215 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van Platerink C. J., Janssen H.-G. M., Haverkamp J. | |
| Title | |
| Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal. Bioanal. Chem., 2008, 391, 299-307. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C10H17N3O4/c11-8(14)4-3-7(10(16)17)13-9(15)6-2-1-5-12-6/h6-7,12H,1-5H2,(H2,11,14)(H,13,15)(H,16,17)/t6-,7-/m0/s1 InChIKey=SHAQGFGGJSLLHE-BQBZGAKWSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8861) |
| Database reference: |
| AHTPDB: ID 3022, 3327, 3446, 3529, 3580, 4009, 6740 BioPepDB: ID biopep01085 BIOPEP-UWM database of bioactive peptides: ID 8861 BRENDA: Ligand Pro-Gln ChEBI: ID 74757 ChEMBL: ID CHEMBL1221834 EPA DSSTox: ID DTXSID50428578 FeptideDB: ID 7837; 8861 Metabolights: ID MTBLC74757 PlantPepDB: ID PPepDB_167 PubChem: CID 7408110 SATPdb: ID satpdb16595 SureChEMBL: ID SCHEMBL5970814 ZINC: ID ZINC000004899448 |