BIOPEP-UWM: Report
| ID | 7840 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1; MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 275.3007 | Monoisotopic mass | 275.1476 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van Platerink C. J., Janssen H.-G. M., Haverkamp J. | |
| Title | |
| Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal. Bioanal. Chem., 2008, 391, 299-307. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: C(CCN)C[C@@H](C(=O)O)NC(=O)[C@H](CCC(=O)O)N InChI=1S/C11H21N3O5/c12-6-2-1-3-8(11(18)19)14-10(17)7(13)4-5-9(15)16/h7-8H,1-6,12-13H2,(H,14,17)(H,15,16)(H,18,19)/t7-,8-/m0/s1 InChIKey=BBBXWRGITSUJPB-YUMQZZPRSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5; MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8558), the EROP-Moscow database Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 364) |
| Database reference: |
| AHTPDB: ID 3292; 3328; 3447; 3474; 3900; 6743 BindingDB: ID 50169173 BIOPEP-UWM database of bioactive peptides: ID 8558 BIOPEP-UWM database of sensory peptides and amino acids: ID 364 CAS: Registry No 5891-53-2 ChEBI: ID 73521 ChEMBL: ID CHEMBL190361 ChemSpider: ID 5378736 DFBP: ID DFBPDPIV0033; DFBPACEI0846; DFBPMUFU0493 EROP-Moscow: ID E10604 FooDB: ID FDB023334 HMDB: ID MDB00000443 J-GLOBAL: ID 200907083472142979 MarkerDB: ID MDB00000443 Metabolomics Workbench: ID 78787 Nikkaji: ID J662.650E PubChem: ID 7015703 SATPdb: ID satpdb10282 SureChEMBL: ID SCHEMBL170727 Wikidata: ID Q27140603 ZINC: ID ZINC000002516165 |