BIOPEP-UWM: Report
| ID | 7843 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 2 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 252.2691 | Monoisotopic mass | 252.1219 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| van Platerink C. J., Janssen H.-G. M., Haverkamp J. | |
| Title | |
| Application of at-line two-dimensional liquid chromatography-mass spectrometry for identification of small hydrophilic angiotensin I-inhibiting peptides in milk hydrolysates. Anal. Bioanal. Chem., 2008, 391, 299-307. | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@H](CCC1)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)O InChI=1S/C11H16N4O3/c16-10(8-2-1-3-13-8)15-9(11(17)18)4-7-5-12-6-14-7/h5-6,8-9,13H,1-4H2,(H,12,14)(H,15,16)(H,17,18)/t8-,9-/m0/s1 InChIKey=BEPSGCXDIVACBU-IUCAKERBSA-N Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) according to the BIOPEP-UWM database of bioactive peptides (ID 8856) |
| Database reference: |
| AHTPDB: ID 3019, 3076, 3349, 3450, 3577, 4003, 6746 BioPepDB: ID biopep01053 BIOPEP-UWM database of bioactive peptides: ID 8856 ChemSpider: ID 8032053 FeptideDB: ID 7843, 8856 SATPdb: ID satpdb21800 PubChem: CID 9856353 |