BIOPEP-UWM: Report
| ID | 7892 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 668.8506 | Monoisotopic mass | 668.3781 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernández-Ledesma B., Dávalos, Bartolomé B., Amigo L. | |
| Title | |
| Preparation of antioxidant enzymatic hydrolysates from α-lactalbumin and β-lactoglobulin. Identification of active peptides by HPLC-MS/MS. J. Agric. Food Chem., 53, 588–593, 2005 | |
| Year | Source |
| 2005 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCSC)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C32H47N9O6/c1-18(2)12-26(41-29(43)23(34)13-20-15-36-24-9-5-4-8-22(20)24)30(44)38-19(3)28(42)40-27(14-21-16-35-17-37-21)31(45)39-25(32(46)47)10-6-7-11-33/h4-5,8-9,15-19,23,25-27,36H,6-7,10-14,33-34H2,1-3H3,(H,35,37)(H,38,44)(H,39,45)(H,40,42)(H,41,43)(H,46,47)/t19-,23-,25-,26-,27-/m0/s1 InChIKey=UNCFHTSHQCTTCP-XAQOOIOESA-N Peptide obtained by hydrolysis of milk beta-lactoglobulin A by use of corolase PP. |
| Database reference: |