BIOPEP-UWM: Report
| ID | 7900 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| ORAC* value of 4,45 μmol Trolox** equivs μmol-1 of peptide. *ORAC - Oxygen Radical Absorbance Capacity. **Trolox - 6-hydroxy-2,5,7,8-tetramethylchroman-2-carboxylic acid. | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 454.4747 | Monoisotopic mass | 454.1846 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Amigo L., Recio I., Bartolome B. | |
| Title | |
| ACE-inhibitory and radical scavenging activity of peptides derived from β-lactoglobulin f(19-25). Interactions with ascorbic acid. J. Agric. Food Chem., 55 (2007), 3392-3397. | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C23H26N4O6/c24-17(10-14-11-25-18-4-2-1-3-16(14)18)21(30)26-19(9-13-5-7-15(29)8-6-13)22(31)27-20(12-28)23(32)33/h1-8,11,17,19-20,25,28-29H,9-10,12,24H2,(H,26,30)(H,27,31)(H,32,33)/t17-,19-,20-/m0/s1 InChIKey=ZJPSMXCFEKMZFE-IHPCNDPISA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the EROP-Moscow database |
| Database reference: |
| AHTPD: ID ahtpdb_5091 ChEBI: ID 164907 DFBP: ID DFBPANOX0291; DFBPANOX0838 EROP-Moscow: ID E10363 Metabolomics Workbench: ID 86231 PubChem: CID 145458531 SATPdB: ID satpdb14392 |