BIOPEP-UWM: Report
| ID | 7904 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 5 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 491.6017 | Monoisotopic mass | 491.2405 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Miguel M., Manso M., Aleixandre A., Alonso M. J., Salaices M., López-Fandiño R. | |
| Title | |
| Vascular effects, angiotensin I-converting enzyme (ACE)-inhibitory activity, and antihypertensive properties of peptides derived from egg white. J. Agric. Food Chem., 55, 10615-10621, 2007 | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C20H37N5O7S/c1-10(2)8-15(25-17(28)11(3)22-18(29)13(21)9-26)19(30)23-12(4)16(27)24-14(20(31)32)6-7-33-5/h10-15,26H,6-9,21H2,1-5H3,(H,22,29)(H,23,30)(H,24,27)(H,25,28)(H,31,32)/t11-,12-,13-,14-,15-/m0/s1 InChIKey=LDWDZYPQLLHBHC-YTFOTSKYSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides; the DFBP database; the EROP-Moscow database |
| Database reference: |
| DFBP: ID DFBPANOX0973; DFBPACEI1877; DFBPMUFU0581 EROP-Moscow: ID E09213 J-GLOBAL: ID 200907023882857107 Nikkaji: ID J2.047.295B PubChem: CID 101730517 |