BIOPEP-UWM: Report
| ID | 7905 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 840.9841 | Monoisotopic mass | 840.3827 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Amigo L., Recio I., Bartolome B. | |
| Title | |
| ACE-inhibitory and radical scavenging activity of peptides derived from β-lactoglobulin f(19-25). Interactions with ascorbic acid. J. Agric. Food Chem., 55 (2007), 3392-3397. | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C40H56N8O10S/c1-21(2)16-31(37(54)43-22(3)34(51)45-30(14-15-59-5)36(53)44-23(4)40(57)58)47-39(56)33(20-49)48-38(55)32(17-24-10-12-26(50)13-11-24)46-35(52)28(41)18-25-19-42-29-9-7-6-8-27(25)29/h6-13,19,21-23,28,30-33,42,49-50H,14-18,20,41H2,1-5H3,(H,43,54)(H,44,53)(H,45,51)(H,46,52)(H,47,56)(H,48,55)(H,57,58)/t22-,23-,28-,30-,31-,32-,33-/m0/s1 InChIKey=AAFTWQSHOBITFF-NFUJUSGDSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides; the DFBP database; the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 6966 DFBP: ID DFBPACEI0082; DFBPANOX0296; DFBPMUFU0040 EROP-Moscow: ID E10367 SATPdb: ID satpdb22910 |