BIOPEP-UWM: Report
| ID | 7956 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 443.4917 | Monoisotopic mass | 443.2049 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saito K., Jin D.-H., Ogawa T., Muramoto K., Hatakeyama E., Yasuhara T., Nokihara K. | |
| Title | |
| Antioxidative properties of tripeptide libraries prepared by the combinatorial chemistry. J. Agric. Food Chem., 51 (2003), 3668-3674. | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C23H29N3O6/c1-13(2)20(24)22(30)25-18(11-14-3-7-16(27)8-4-14)21(29)26-19(23(31)32)12-15-5-9-17(28)10-6-15/h3-10,13,18-20,27-28H,11-12,24H2,1-2H3,(H,25,30)(H,26,29)(H,31,32)/t18-,19-,20-/m0/s1 InChIKey=OWFGFHQMSBTKLX-UFYCRDLUSA-N Anti-inflammatory peptide according to the BIOPEP-UWM database of bioactive peptides (ID 9857); the EROP-Moscow database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9857 EROP-Moscow: ID E23775 FeptideDB: ID 7956 PubChem: CID 145459081 |