BIOPEP-UWM: Report
| ID | 7967 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Free radical scavenger | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 401.4122 | Monoisotopic mass | 401.1581 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saito K., Jin D.-H., Ogawa T., Muramoto K., Hatakeyama E., Yasuhara T., Nokihara K. | |
| Title | |
| Antioxidative properties of tripeptide libraries prepared by the combinatorial chemistry. J. Agric. Food Chem., 51 (2003), 3668-3674. | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O InChI=1S/C20H23N3O6/c21-16(9-12-1-5-14(24)6-2-12)19(27)22-11-18(26)23-17(20(28)29)10-13-3-7-15(25)8-4-13/h1-8,16-17,24-25H,9-11,21H2,(H,22,27)(H,23,26)(H,28,29)/t16-,17-/m0/s1 InChIKey: NMKJPMCEKQHRPD-UHFFFAOYSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: XM02-001) according to AHTPDB database Bitter peptide according to BIOPEP database of sensory peptides and amino acids |
| Database reference: |
| AHTPDB: ID 4564; 4865; 5478 BIOPEP database of sensory peptides and amino acids: ID 38 ChemSpider: ID 16575494 |