BIOPEP-UWM: Report
| ID | 8005 |
| Name | synthetic peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 388.4596 | Monoisotopic mass | 388.2104 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saito K., Jin D.-H., Ogawa T., Muramoto K., Hatakeyama E., Yasuhara T., Nokihara K. | |
| Title | |
| Antioxidative properties of tripeptide libraries prepared by the combinatorial chemistry. J. Agric. Food Chem., 51 (2003), 3668-3674. | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1c[nH]c2c1cccc2)C(=O)N[C@@H](C)C(=O)O InChI=1S/C20H28N4O4/c1-11(2)8-15(21)18(25)24-17(19(26)23-12(3)20(27)28)9-13-10-22-16-7-5-4-6-14(13)16/h4-7,10-12,15,17,22H,8-9,21H2,1-3H3,(H,23,26)(H,24,25)(H,27,28)/t12-,15-,17-/m0/s1 InChIKey: CNWDWAMPKVYJJB-NUTKFTJISA-N |
| Database reference: |