BIOPEP-UWM: Report
| ID | 8032 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 380.3980 | Monoisotopic mass | 380.1803 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Saito K., Jin D.-H., Ogawa T., Muramoto K., Hatakeyama E., Yasuhara T., Nokihara K. | |
| Title | |
| Antioxidative properties of tripeptide libraries prepared by the combinatorial chemistry. J. Agric. Food Chem., 51 (2003), 3668-3674. | |
| Year | Source |
| 2003 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@H](CCC1)C(=O)N[C@@H](CC2=C[N]([H])C=N2)C(=O)N[C@@H](CCC(=O)N)C(=O)O InChI=1S/C16H24N6O5/c17-13(23)4-3-11(16(26)27)21-15(25)12(6-9-7-18-8-20-9)22-14(24)10-2-1-5-19-10/h7-8,10-12,19H,1-6H2,(H2,17,23)(H,18,20)(H,21,25)(H,22,24)(H,26,27)/t10-,11-,12-/m0/s1 InChIKey=SSWJYJHXQOYTSP-SRVKXCTJSA-N |
| Database reference: |
| ChEBI: ID 162347 FeptideDB: ID 8032 PubChem: CID 145457481 |