BIOPEP-UWM: Report
| ID | 8126 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 335.3971 | Monoisotopic mass | 335.1839 | |
| IC50 : | 35.80 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K., Chen J.-R. | |
| Title | |
| Identification of antihypertensive peptides from peptic digest of two microalgae, Chlorella vulgaris and Spirulina platensis. Marine Biotechnol., 3, 305–309, 2001 | |
| Year | Source |
| 2001 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(Cc1ccccc1)C(=O)O InChI=1S/C17H25N3O4/c1-10(2)14(18)16(22)19-11(3)15(21)20-13(17(23)24)9-12-7-5-4-6-8-12/h4-8,10-11,13-14H,9,18H2,1-3H3,(H,19,22)(H,20,21)(H,23,24)/t11-,13-,14-/m0/s1 InChIKey: JFAWZADYPRMRCO-UBHSHLNASA-N Information concerning Angiotensin-Converting Enzyme (ACE) is available in MEROPS database of proteolytic enzymes (http://merops.sanger.ac.uk/); ID: M02-001 |
| Database reference: |
| AHTPDB: ID 1038, 1870 EROP-Moscow: ID E07058 SATPdb: ID satpdb14951 |