BIOPEP-UWM: Report
| ID | 8130 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 346.3784 | Monoisotopic mass | 346.1846 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K. | |
| Title | |
| Separation and identification of antioxidant peptides from proteolytic digest of dried bonito. Nippon Suisan Gakkaishi (Japanese Edition), 65 (1999), 92-96. | |
| Year | Source |
| 1999 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C14H26N4O6/c1-8(17-13(22)9(16)5-6-11(19)20)12(21)18-10(14(23)24)4-2-3-7-15/h8-10H,2-7,15-16H2,1H3,(H,17,22)(H,18,21)(H,19,20)(H,23,24)/t8-,9-,10-/m0/s1 InChIKey= JJKKWYQVHRUSDG-GUBZILKMSA-N |
| Database reference: |