BIOPEP-UWM: Report
| ID | 8139 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative; IC50 = 306μM (SOSA - superoxide anion scavenging activity) by using tetrazolium salt XTT method. | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 357.4010 | Monoisotopic mass | 357.1893 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Suetsuna K., Ukeda H., Ochi H. | |
| Title | |
| Isolation and characterization of free radical scavenging activities peptides derived from casein. J. Nutr. Biochem., 11 (2000), 128–131. | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C16H27N3O6/c1-9(2)8-12(16(24)25)19-15(23)11(5-6-13(20)21)18-14(22)10-4-3-7-17-10/h9-12,17H,3-8H2,1-2H3,(H,18,22)(H,19,23)(H,20,21)(H,24,25)/t10-,11-,12-/m0/s1 InChIKey=NXEYSLRNNPWCRN-SRVKXCTJSA-N Synthetic peptide - fragment of antioxidant peptide from peptic hydrolysate of casein. |
| Database reference: |
| ChEBI: ID 162277 EROP-Moscow: ID E25718 FeptideDB: ID 8139 PubChem: CID 145457461 |