BIOPEP-UWM: Report
| ID | 8179 |
| Name | Peptide derived from ovine alpha S2-casein (165–170) |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 6 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 715.8792 | Monoisotopic mass | 715.4578 | |
| IC50 : | 2.60 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lopez-Exposito I., Quiros A., Amigo L., Recio I. | |
| Title | |
| Casein hydrolysates as a source of antimicrobial, antioxidant and antihypertensive peptides. Lait, 87 (2007), 241–249. | |
| Year | Source |
| 2007 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@]([H])(C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(N)=O)C(O)=O)[C@@]([H])(C)CC InChI=1S/C32H61N9O9/c1-5-19(4)26(31(48)40-24(17-42)30(47)39-23(32(49)50)12-13-25(36)43)41-29(46)22(11-7-9-15-34)38-28(45)21(10-6-8-14-33)37-27(44)20(35)16-18(2)3/h18-24,26,42H,5-17,33-35H2,1-4H3,(H2,36,43)(H,37,44)(H,38,45)(H,39,47)(H,40,48)(H,41,46)(H,49,50)/t19-,20-,21-,22-,23-,24-,26-/m0/s1 InChIKey=BTDBLUHFSDYXHC-HXDUVXNTSA-N Peptide obtained by hydrolysis of ovine alpha S2-casein by use of porcine pepsin A. Antibacterial peptide according to the BIOPEP-UWM database of bioactive peptides (ID 3961); the EROP-Moscow database; the MBPDB database |
| Database reference: |
| AHTPDB: ID 4312, 5690 BioPepDB: biopep00802 BIOPEP-UWM database of bioactive peptides: ID 3961 ChemSpider: ID 17259297 EPA DSSTox: ID DTXSID60582857 EROP-Moscow: ID E23859 FeptideDB: ID 3971; 8179 MBPDB: Peptide LKKISQ PubChem: CID 16101417 SATPdb: ID satpdb26574 |