BIOPEP-UWM: Report
| ID | 8221 |
| Name | antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 378.3772 | Monoisotopic mass | 378.1744 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cheng Y., Chen J., Xiong Y. L. | |
| Title | |
| Chromatographic separation and tandem MS identification of active peptides in potato protein hydrolysate that inhibit autoxidation of soybean oil-in-water emulsions. J. Agric. Food Chem., 58, 8825-8832, 2010 | |
| Year | Source |
| 2010 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C14H26N4O8/c1-5(14(25)26)16-13(24)10(7(3)21)18-11(22)8(4-19)17-12(23)9(15)6(2)20/h5-10,19-21H,4,15H2,1-3H3,(H,16,24)(H,17,23)(H,18,22)(H,25,26)/t5-,6+,7+,8-,9-,10-/m0/s1 InChIKey=VOTHJOIRJPLXJH-RSMBCMNPSA-N |
| Database reference: |
| FeptideDB: ID 8221 |