BIOPEP-UWM: Report
| ID | 8285 |
| Name | antioxidative peptide |
| sequence |
| Function: | |||
| antioxidative | |||
| Number of residues | 7 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 845.0342 | Monoisotopic mass | 844.5042 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Miralles B., Amigo L., Ramos M., Recio I. | |
| Title | |
| Identification of antioxidant and ACE-inhibitory peptides in fermented milk. J. Sci. Food Agric., 85, 1041–1048, 2005 | |
| Year | Source |
| 2005 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H]([C@H](CC)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C42H68N8O10/c1-9-24(7)33(44)41(58)50-19-11-12-31(50)38(55)49-35(25(8)10-2)40(57)45-28(17-18-32(43)52)36(53)46-29(21-26-13-15-27(51)16-14-26)37(54)48-34(23(5)6)39(56)47-30(42(59)60)20-22(3)4/h13-16,22-25,28-31,33-35,51H,9-12,17-21,44H2,1-8H3,(H2,43,52)(H,45,57)(H,46,53)(H,47,56)(H,48,54)(H,49,55)(H,59,60)/t24-,25-,28-,29-,30-,31-,33-,34-,35-/m0/s1 InChIKey=KARMFXIYMLCBHF-VQQWLMHCSA-N |
| Database reference: |
| FeptideDB: ID 8285 |