BIOPEP-UWM: Report
| ID | 8286 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1052.2661 | Monoisotopic mass | 1051.6160 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hernandez-Ledesma B., Miralles B., Amigo L., Ramos M., Recio I. | |
| Title | |
| Identification of antioxidant and ACE-inhibitory peptides in fermented milk. J. Sci. Food Agric., 85, 1041-1048, 2005 | |
| Year | Source |
| 2005 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)O InChI=1S/C51H81N13O11/c1-7-30(5)41(48(72)61-42(50(74)75)31(6)8-2)60-46(70)37-21-15-25-64(37)49(73)34(26-32-16-10-9-11-17-32)58-44(68)35-19-14-24-63(35)39(66)28-56-43(67)33(18-12-22-55-51(53)54)57-47(71)40(29(3)4)59-45(69)36-20-13-23-62(36)38(65)27-52/h9-11,16-17,29-31,33-37,40-42H,7-8,12-15,18-28,52H2,1-6H3,(H,56,67)(H,57,71)(H,58,68)(H,59,69)(H,60,70)(H,61,72)(H,74,75)(H4,53,54,55)/t30-,31-,33-,34-,35-,36-,37-,40-,41-,42-/m0/s1 InChIKey=UMQRNERFPHYGAM-SNDBGJAESA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) accoding to the AHTPDB daatabase; the BIOPEP-UWM database of bioactive peptides (ID 8169); the DFBP database |
| Database reference: |
| AHTPDB: ID 6756 BIOPEP-UWM database of bioactive peptides: ID 8169 DFBP: ID DFBPACEI0861; DFBPANOX0344; DFBPMUFU0185 Peptipedia: ID 291 SATPdb: ID satpdb22162 |