BIOPEP-UWM: Report
| ID | 8313 | 
| Name | Pseudolysin inhibitor | 
| sequence | 
| Function: | |||
| Inhibitor of pseudolysin (EC 3.4.24.26) (MEROPS ID: M04.005) | |||
| Number of residues | 2   | 
    Activity code | pseud   | 
  
| Activity : | pseudolysin inhibitor   | 
  |||
| Chemical mass | 278.3459 | Monoisotopic mass | 278.1625 | |
| EC50 : | 0.00  µM   | 
  |||
| Bibliographic data: | |
| Authors | |
| Kessler E., Israel M., Landshman N., Chechick A., Blumberg S. | |
| Title | |
| In vitro inhibition of Pseudomonas aeruginosa elastase by metal-chelating peptide derivatives. Infect. Immun., 38, 716-723, 1982 | |
| Year | Source | 
| 1982 | Journal | 
| Additional information: | 
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C15H22N2O3/c1-10(2)8-12(16)14(18)17-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20)/t12-,13-/m0/s1 InChIKey=KFKWRHQBZQICHA-STQMWFEESA-N Inhibitor of Carboxypeptidase C (EC 3.4.16.5) (MEROPS ID S10.004) according to the BRENDA database Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 3551); the BRENDA database Bitter peptide according to BIOPEP database of sensory peptides and amino acids (ID 52); the ChEMBL database; the EROP-Moscow database; the PubChem database  | 
  
| Database reference: | 
| AHTPDB: ID 1161; 1330; 1388; 1415; 1432; 1675; 2687; 3165; 3209; 3302; 3514; 3600; 3854; 3976; 4086; 4473; 5454; 5602; 5711; 5777; 6466 BIOPEP-UWM database of bioactive peptides: ID 3551 BIOPEP-UWM database of sensory peptides and amino acids: ID 52 BRENDA: Ligand Leu-Phe CAS: Registry No 3063-05-6 CCDC: ID COCGOQ ChEBI: ID 73585 ChEMBL: ID CHEMBL54936 ChemSpider: ID 5360450 COCONUT: ID CNP0118564.1 eMolecules: ID 8294077 EPA CompTox: ID DTXSID501036415 EROP-Moscow: ID E01831 FooDB: ID FDB111642 HMDB: ID HMDB0013243 J-GLOBAL: ID 200907004967555318 MetaboLights: ID MTBLC73585 Metabolomics Workbench: ID ME015586 Nikkaji: ID J80.629C NMRShiftDB: ID 60023474 PlantPepDB: ID PPepDB_3721 Probes And Drugs: ID PD101959 PubChem: ID 6992310 SATPdb: ID satpdb28695 SureChEMBL: ID SCHEMBL1864709 Wikidata: ID Q27141902 ZINC: ID ZINC000001569745  |