BIOPEP-UWM: Report
| ID | 8327 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 9 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 1016.1086 | Monoisotopic mass | 1015.5184 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Brodsky B., Erlanger-Rosengarten A., Proscura E., Shapira E., Wormser U. | |
| Title | |
| From topical antidote against skin irritants to a novel counter-irritating and antiinflammatory peptide. Toxicol Appl Pharmacol., 229, 342–350, 2008 | |
| Year | Source |
| 2008 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCCCN)C(=O)NCC(=O)N[C@@H](CC1=C[N]([H])C=N1)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)O InChI=1S/C44H69N15O13/c1-23(2)36(43(72)52-21-35(64)65)59-40(69)29(8-6-16-50-44(47)48)57-39(68)30(13-14-34(62)63)56-37(66)24(3)54-41(70)31(17-25-9-11-27(60)12-10-25)58-42(71)32(18-26-19-49-22-53-26)55-33(61)20-51-38(67)28(46)7-4-5-15-45/h9-12,19,22-24,28-32,36,60H,4-8,13-18,20-21,45-46H2,1-3H3,(H,49,53)(H,51,67)(H,52,72)(H,54,70)(H,55,61)(H,56,66)(H,57,68)(H,58,71)(H,59,69)(H,62,63)(H,64,65)(H4,47,48,50)/t24-,28-,29-,30-,31-,32-,36-/m0/s1 InChIKey=YYMGXYCTKSTFPU-HBKAQRFDSA-N |
| Database reference: |
| ChemSpider: ID 8323607 EROP-Moscow: ID E22653 FEptideDB: ID 8327 PepBank: Peptide KGHYAERVG PubChem: CID 10148099 |