BIOPEP-UWM: Report
ID | 8330 |
Name | Stimulating vasoactive substance release |
sequence |
Function: | |||
Stimulating vasoactive substance release | |||
Number of residues | 2 |
Activity code | sti |
Activity : | stimulating |
|||
Chemical mass | 234.2060 | Monoisotopic mass | 234.0848 | |
EC50 : | 0.00 µM |
Bibliographic data: | |
Authors | |
Ringseis R., Motthes B., Lehmann V., Becker K., Schöps R., Ulbrich-Hofmann R., Eder K. | |
Title | |
Peptides and hydrolysates from casein and soy protein modulate the release of vasoactive substances from human aortic endothelial cells. Biochim. Biophys. Acta Gen. Subj., 1721, 89-97, 2005 | |
Year | Source |
2005 | Journal |
Additional information: |
BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C8H14N2O6/c9-4(3-11)7(14)10-5(8(15)16)1-2-6(12)13/h4-5,11H,1-3,9H2,(H,10,14)(H,12,13)(H,15,16)/t4-,5-/m0/s1 InChIKey=LAFKUZYWNCHOHT-WHFBIAKZSA-N |
Database reference: |
ChEBI: ID 74813 FeptideDB: ID 8330 HMDB: ID HMDB0029038 J-GLOBAL: ID 200907019704290104 Nikkaji: ID J1.912.514I PubChem: CID 7023503 ZINC: ID ZINC000002597015 |