BIOPEP-UWM: Report
| ID | 8453 |
| Name | Antioxidant peptide from marine bivalve (Mactra veneriformis) |
| sequence |
| Function: | |||
| Antioxidative peptide | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 409.4325 | Monoisotopic mass | 409.1842 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu R., Zheng W., Li J., Wang L., Wu H., Wang X., Shi L. | |
| Title | |
| Rapid identification of bioactive peptides with antioxidant activity from the enzymatic hydrolysate of Mactra veneriformis by UHPLC–Q-TOF mass spectrometry. Food Chemistry 167, 484-489, 201510.1016/j.foodchem.2014.06.113. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(Cc1ccc(O)cc1)C(=O)O InChI=1S/C19H27N3O7/c1-10(2)7-13(20)17(26)21-14(9-16(24)25)18(27)22-15(19(28)29)8-11-3-5-12(23)6-4-11/h3-6,10,13-15,23H,7-9,20H2,1-2H3,(H,21,26)(H,22,27)(H,24,25)(H,28,29)/t13-,14-,15-/m0/s1 InChIKey: QLQHWWCSCLZUMA-KKUMJFAQSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database (ID 9228) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 9228 ChEBI: ID 73564 ChemSpider: ID28639368 |