BIOPEP-UWM: Report
| ID | 8463 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 10 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 1231.3955 | Monoisotopic mass | 1230.6377 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Najafian L., Babji A.S. | |
| Title | |
| Isolation, purification and identification of three novel antioxidative peptides from patin (Pangasius sutchi) myofibrillar protein hydrolysates. LWT - Food Science and Technology 60, 452-461 (2015) | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](C)(CC)[C@]([H])(NC(=O)[C@]([H])(CC(O)=O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)[C@]([H])(Cc1ccccc1)NC(=O)[C@]([H])(Cc1ccc(O)cc1)NC(=O)[C@]([H])(CC(N)=O)NC(=O)[C@]([H])(CCCCN)NC(=O)[C@]1([H])CCCN1C(=O)[C@@]([H])(N)C(C)C)C(=O)N[C@@]([H])(C(C)C)C(O)=O InChI=1S/C59H86N14O15/c1-7-33(6)49(57(85)71-48(32(4)5)59(87)88)72-55(83)43(28-46(76)77)70-53(81)41(26-36-29-63-30-64-36)68-52(80)39(24-34-14-9-8-10-15-34)66-51(79)40(25-35-18-20-37(74)21-19-35)67-54(82)42(27-45(61)75)69-50(78)38(16-11-12-22-60)65-56(84)44-17-13-23-73(44)58(86)47(62)31(2)3/h8-10,14-15,18-21,29-33,38-44,47-49,74H,7,11-13,16-17,22-28,60,62H2,1-6H3,(H2,61,75)(H,63,64)(H,65,84)(H,66,79)(H,67,82)(H,68,80)(H,69,78)(H,70,81)(H,71,85)(H,72,83)(H,76,77)(H,87,88)/t33-,38-,39-,40-,41-,42-,43-,44-,47-,48-,49-/m0/s1 InChIKey: HJMURQCGHQSGQM-VAPYVCGISA-N |
| Database reference: |
| J-GLOBAL: ID 201507064161517190 Nikkaji: ID J3.360.318E PubChem: CID 101887767 |