BIOPEP-UWM: Report
| ID | 8490 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 969.0869 | Monoisotopic mass | 968.5161 | |
| IC50 : | 45.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lacroix I. M. E., Li-Chan E. C. Y. | |
| Title | |
| Isolation and characterization of peptides with dipeptidyl peptidase-IV inhibitory activity from pepsin-treated bovine whey proteins. Peptides, 54, 39-48. | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
BIOPEP database of bioactive peptides SMILES: N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N1CCC[C@@H]1C(=O)N[C@@H]([C@@H](C)O)C(=O)N1CCC[C@@H]1C(=O)N[C@@H](CCC(=O)O)C(=O)NCC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CC(C)C)C(=O)O InChI=1S/C43H72N10O15/c1-22(2)18-25(45)36(60)49-27(10-6-7-15-44)41(65)52-16-8-12-31(52)40(64)51-35(24(5)54)42(66)53-17-9-11-30(53)39(63)48-26(13-14-33(56)57)37(61)46-21-32(55)47-28(20-34(58)59)38(62)50-29(43(67)68)19-23(3)4/h22-31,35,54H,6-21,44-45H2,1-5H3,(H,46,61)(H,47,55)(H,48,63)(H,49,60)(H,50,62)(H,51,64)(H,56,57)(H,58,59)(H,67,68)/t24-,25+,26+,27+,28+,29+,30-,31-,35+/m1/s1 InChIKey: QAAFYGADSHNWTA-OOZJMILQSA-N |
| Database reference: |