BIOPEP-UWM: Report
| ID | 8491 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 12 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1324.5150 | Monoisotopic mass | 1323.7261 | |
| IC50 : | 57.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lacroix I. M. E., Li-Chan E. C. Y. | |
| Title | |
| Isolation and characterization of peptides with dipeptidyl peptidase-IV inhibitory activity from pepsin-treated bovine whey proteins. Peptides, 54, 39-48. | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C60H101N13O20/c1-10-33(8)48(57(89)69-41(60(92)93)27-32(6)7)70-52(84)37(19-21-46(78)79)65-53(85)39(26-31(4)5)68-54(86)40(28-47(80)81)64-44(75)29-63-51(83)36(18-20-45(76)77)66-55(87)42-16-14-24-73(42)59(91)49(34(9)74)71-56(88)43-17-13-23-72(43)58(90)38(15-11-12-22-61)67-50(82)35(62)25-30(2)3/h30-43,48-49,74H,10-29,61-62H2,1-9H3,(H,63,83)(H,64,75)(H,65,85)(H,66,87)(H,67,82)(H,68,86)(H,69,89)(H,70,84)(H,71,88)(H,76,77)(H,78,79)(H,80,81)(H,92,93)/t33-,34+,35-,36-,37-,38-,39-,40-,41-,42-,43-,48-,49-/m0/s1 InChIKey= QSUPAGYATLENCN-YKGXBYSXSA-N |
| Database reference: |