BIOPEP-UWM: Report
| ID | 8499 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 327.2926 | Monoisotopic mass | 327.1175 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ghribi A.M., Sila A., Przybylski R., Nedjar-Arroume N., Makhlouf I., Blecker C., Attia H., Dhulster P., Bougatef A., Besbes S. | |
| Title | |
| Purification and identification of novel antioxidant peptides from enzymatic hydrolysate of chickpea (Cicer arietinum L.) protein concentrate. Journal of Functional Foods 12, 516-525 (2015) | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(CC(O)=O)C(=O)N[C@@]([H])(CC1=CN=CN1)C(=O)NCC(O)=O InChI=1S/C12H17N5O6/c13-7(2-9(18)19)11(22)17-8(1-6-3-14-5-16-6)12(23)15-4-10(20)21/h3,5,7-8H,1-2,4,13H2,(H,14,16)(H,15,23)(H,17,22)(H,18,19)(H,20,21)/t7-,8-/m0/s1 InChIKey: ILQCHXURSRRIRY-YUMQZZPRSA-N |
| Database reference: |
| EROP-Moscow: ID E24219 FeptideDB: ID 8499 PubChem: CID 145454448 |