BIOPEP-UWM: Report
| ID | 8502 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 4 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 402.4415 | Monoisotopic mass | 402.2107 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ghribi A.M., Sila A., Przybylski R., Nedjar-Arroume N., Makhlouf I., Blecker C., Attia H., Dhulster P., Bougatef A., Besbes S. | |
| Title | |
| Purification and identification of novel antioxidant peptides from enzymatic hydrolysate of chickpea (Cicer arietinum L.) protein concentrate. Journal of Functional Foods 12, 516-525. | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: [H][C@](N)(C(C)C)C(=O)NCC(=O)N[C@@]([H])(CC(O)=O)C(=O)N[C@@]([H])([C@@H](C)CC)C(O)=O InChI=1S/C17H30N4O7/c1-5-9(4)14(17(27)28)21-15(25)10(6-12(23)24)20-11(22)7-19-16(26)13(18)8(2)3/h8-10,13-14H,5-7,18H2,1-4H3,(H,19,26)(H,20,22)(H,21,25)(H,23,24)(H,27,28)/t9-,10-,13-,14-/m0/s1 InChIKey: QAMTWBQBGAVRHZ-NUZBWSBOSA-N |
| Database reference: |
| EROP-Moscow: ID E24220 FeptideDB: ID 8502 |