BIOPEP-UWM: Report
| ID | 8503 |
| Name | Dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 216.2337 | Monoisotopic mass | 216.1106 | |
| IC50 : | 2370.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hatanaka T., Inoue Y., Arima J., Kumagai Y., Usuki H., Kawakami K., Kimura M., Mukaihara T. | |
| Title | |
| Production of dipeptidyl peptidase IV inhibitory peptides from defated rice bran. Food Chem., 134, 797-802, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C9H16N2O4/c1-5(12)7(10)8(13)11-4-2-3-6(11)9(14)15/h5-7,12H,2-4,10H2,1H3,(H,14,15)/t5?,6-,7-/m0/s1 InChIKey: QOLYAJSZHIJCTO-BYRXKDITSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database (ID 9073); the BRENDA database; the ChEMBL database Sour peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 526) |
| Database reference: |
| AHTPDB: ID 1393, 1451, 4718, 5175, 5644, 6164 BindingDB: ID 50049714 BioPepDB: ID biopep01298 BIOPEP-UWM database of bioactive peptides: ID 9073 BIOPEP-UWM database of sensory peptides and amino acids: ID 526 BRENDA: Ligand Thr-Pro ChEBI: ID 73662 ChEMBL: ID CHEMBL3321984 ChemSpider: ID 8010092 EPA CompTox: ID DTXSID40431470 J-GLOBAL: ID 200907063825682360 Metabolights: ID MTBLC73662 Nikkaji: ID J908.017A PubChem: CID 9834371 SATPdb: ID satpdb27701 ZINC: ID ZINC000008076550 |