BIOPEP-UWM: Report
| ID | 8530 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 229.2325 | Monoisotopic mass | 229.1059 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hikida A., Ito K., Motoyama T., Kato R., Kawarasaki Y. | |
| Title | |
| Systematic analysis of a dipeptide library for inhibitor development using human dipeptidyl peptidase IV produced by a Saccharomyces cerevisiae expression system. Biochemical and Biophysical Research Communications 430, 1217-1222, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C9H15N3O4/c10-5(4-7(11)13)8(14)12-3-1-2-6(12)9(15)16/h5-6H,1-4,10H2,(H2,11,13)(H,15,16)/t5-,6-/m0/s1 InChIKey=GADKFYNESXNRLC-WDSKDSINSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the EROP-Moscow database Umami peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 530) |
| Database reference: |
| Database reference: AHTPDB: ID 1397, 4732, 5168, 6166 BioPepDB: ID biopep01014 BIOPEP-UWM database of sensory peptides and amino acids: ID 530 ChEBI: ID 73425 EPA CompTox: ID DTXSID80432840 EROP-Moscow: ID E25610 FeptideDB: ID 8530 FooDB: ID FDB111795 HMDB: ID HMDB0028739 J-GLOBAL: ID 200907001333275119 MeSH: ID C113843; term Asn-Pro Nikkaji: ID J1.158.501I PubChem: CID 9920984 SATPdb: ID satpdb14623 SureChEMBL: ID SCHEMBL7293358 |