BIOPEP-UWM: Report
| ID | 8591 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 503.5897 | Monoisotopic mass | 503.2735 | |
| IC50 : | 65.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., FitzGerald R. J. | |
| Title | |
| Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides. J. Funct. Foods, 5, 1909-1917, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C25H37N5O6/c1-15(2)13-19(29-22(32)17(26)14-16-7-4-3-5-8-16)23(33)28-18(10-11-21(27)31)24(34)30-12-6-9-20(30)25(35)36/h3-5,7-8,15,17-20H,6,9-14,26H2,1-2H3,(H2,27,31)(H,28,33)(H,29,32)(H,35,36)/t17-,18-,19-,20-/m0/s1 InChIKey= YKQNVNONYGLMFH-MUGJNUQGSA-N |
| Database reference: |