BIOPEP-UWM: Report
| ID | 8594 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 273.3311 | Monoisotopic mass | 273.1796 | |
| IC50 : | 826.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., FitzGerald R. J. | |
| Title | |
| Inhibition of dipeptidyl peptidase IV (DPP-IV) by proline containing casein-derived peptides. J. Funct. Foods, 5, 1909-1917, 2013 | |
| Year | Source |
| 2013 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](C(C)C)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O InChI=1S/C11H23N5O3/c1-6(2)8(12)9(17)16-7(10(18)19)4-3-5-15-11(13)14/h6-8H,3-5,12H2,1-2H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 InChIKey: IBIDRSSEHFLGSD-YUMQZZPRSA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 7628); the EROP-Moscow database; the MBPDB database Salty taste enhancing peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 425) |
| Database reference: |
| AHTPDB: ID 1002; 1080; 1996; 2633; 3183; 3258; 3429; 3545; 3707; 4044; 6615 BioPepDB: ID biopep01446 BIOPEP-UWM database of bioactive peptides: ID 7628 BIOPEP-UWM database of sensory peptides and amino acids: ID 425 ChEBI: ID 73711 ChemSpider: ID 392436 EROP-Moscow: ID E14721 FeptideDB: ID 7628; 8594 FooDB: ID FDB112123 HMDB: ID HMDB0029121 J-GLOBAL: ID 200907048838766660 MBPDB: peptide VR MMDB: ID 4469.4 Nikkaji: ID J2.769.909J PlantPepDB: ID PPepDB_212 PubChem: CID 444523 SATPdb: ID satpdb24361 SureChEMBL: ID SCHEMBL7098551 ZINC: ID ZINC02047887 |