BIOPEP-UWM: Report
| ID | 8613 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 632.7463 | Monoisotopic mass | 632.3522 | |
| IC50 : | 35.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., FitzGerald R. J. | |
| Title | |
| Susceptibility of milk protein-derived peptides to dipeptidyl peptidase IV (DPP-IV) hydrolysis. Food Chemistry 145, 845-852, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H]([C@H](CC)C)C(=O)N1[C@@H](CCC1)C(=O)N[C@@H]([C@H](CC)C)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)O InChI=1S/C31H48N6O8/c1-5-17(3)25(33)30(43)37-15-7-8-23(37)28(41)36-26(18(4)6-2)29(42)34-21(13-14-24(32)39)27(40)35-22(31(44)45)16-19-9-11-20(38)12-10-19/h9-12,17-18,21-23,25-26,38H,5-8,13-16,33H2,1-4H3,(H2,32,39)(H,34,42)(H,35,40)(H,36,41)(H,44,45)/t17-,18-,21-,22-,23-,25-,26-/m0/s1 InChIKey=OPQWYASDQPRQGD-DSZQHYJTSA-N |
| Database reference: |
| EROP-Moscow: ID E24440 FeptideDB: ID 8613 FermFooDB: ID FMDB1308, FMDB1855, FMDB953 MBPDB: Peptide IPIQY PubChem: CID 101898310 |