BIOPEP-UWM: Report
| ID | 8618 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 551.7166 | Monoisotopic mass | 551.3671 | |
| IC50 : | 325.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., FitzGerald R. J. | |
| Title | |
| Susceptibility of milk protein-derived peptides to dipeptidyl peptidase IV (DPP-IV) hydrolysis. Food Chemistry 145, 845-852, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C28H49N5O6/c1-16(2)13-19(29)26(36)32-11-7-9-22(32)24(34)30-20(14-17(3)4)27(37)33-12-8-10-23(33)25(35)31-21(28(38)39)15-18(5)6/h16-23H,7-15,29H2,1-6H3,(H,30,34)(H,31,35)(H,38,39)/t19-,20-,21-,22-,23-/m0/s1 InChIKey=KCPMPYBJPBRURZ-VUBDRERZSA-N |
| Database reference: |
| EROP-Moscow: ID E24443 FeptideDB: ID 8618 MBPDB: Peptide LPLPL PubChem: CID 134827533 |