BIOPEP-UWM: Report
| ID | 8647 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 412.5222 | Monoisotopic mass | 412.2677 | |
| IC50 : | 43.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Harnedy P. A., O’Keeffe M. B., FitzGerald R. J. | |
| Title | |
| Purification and identification of dipeptidyl peptidase (DPP) IV inhibitory peptides from the macroalga Palmaria palmata. Food Chemistry 172, 400-406, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C20H36N4O5/c1-6-12(4)16(21)18(26)23-14(10-11(2)3)17(25)22-13(5)19(27)24-9-7-8-15(24)20(28)29/h11-16H,6-10,21H2,1-5H3,(H,22,25)(H,23,26)(H,28,29)/t12-,13-,14-,15-,16-/m0/s1 InChIKey= QPWJPUVZYLAXCK-QXKUPLGCSA-N |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 241 |