BIOPEP-UWM: Report
| ID | 8652 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 325.4022 | Monoisotopic mass | 325.1995 | |
| IC50 : | 390.14 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lafarga T., O’Connor P., Hayes M. | |
| Title | |
| Identification of novel dipeptidyl peptidase-IV and angiotensin-I-converting enzyme inhibitory peptides from meat proteins using in silico analysis. Peptides 59, 53-62, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C16H27N3O4/c1-10(2)9-12(16(22)23)18-14(20)13-6-4-8-19(13)15(21)11-5-3-7-17-11/h10-13,17H,3-9H2,1-2H3,(H,18,20)(H,22,23)/t11-,12-,13-/m0/s1 InChIKey=CGSOWZUPLOKYOR-AVGNSLFASA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BindingDB database; the BIOPEP-UWM database of bioactive peptides (ID 9908); the ChEMBL database; the EROP-Moscow database; the PubChem database |
| Database reference: |
| AHTPDB: ID ahtpdb_1957 BindingDB: ID 50348859 BioPepDB: ID biopep01080 BIOPEP-UWM database of bioactive peptides: ID 9908 ChEBI: ID 162598 ChEMBL: ID CHEMBL1807691 ChemSpider: ID 10032763 EROP-Moscow: ID E26062 FeptideDB: ID 8652 J-GLOBAL: ID 201507031190847837 Nikkaji: ID J3.367.833I PubChem: CID 11858292 SATPdb: ID satpdb10190 ZINC: ID ZINC000036489331 |