BIOPEP-UWM: Report
| ID | 8653 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 269.2962 | Monoisotopic mass | 269.1371 | |
| IC50 : | 2252.68 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lafarga T., O’Connor P., Hayes M. | |
| Title | |
| Identification of novel dipeptidyl peptidase-IV andangiotensin-I-converting enzyme inhibitory peptides from meatproteins using in silico analysis. Peptides 59, 53-62 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP database of bioactive peptides SMILES: N1[C@H](C(=O)N2[C@H](C(=O)NCC(=O)O)CCC2)CCC1 InChI=1S/C12H19N3O4/c16-10(17)7-14-11(18)9-4-2-6-15(9)12(19)8-3-1-5-13-8/h8-9,13H,1-7H2,(H,14,18)(H,16,17)/t8-,9-/m0/s1 InChIKey: LEIKGVHQTKHOLM-IUCAKERBSA-N Bitter peptide according to BIOPEP database of sensory peptides and amino acids |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 63 ChEMBL: ID CHEMBL288208 ChemIDplus: ID 16875-10-8 ChemSpider: ID 134149 Comparative Toxicogenomics Database (CTD): ID 16875-10-8 EROP-Moscow: ID E09210; E09279 PubChem: ID 152199 |