BIOPEP-UWM: Report
| ID | 8654 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 300.3102 | Monoisotopic mass | 300.1429 | |
| IC50 : | 41.90 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zheng L., Xu Q., Lin L., Zeng X. A., Sun B., Zhao M. | |
| Title | |
| In vitro metabolic stability of a casein-derived dipeptidyl peptidase-IV (DPP-IV) inhibitory peptide VPYPQ and its controlled release from casein by enzymatic hydrolysis. J Agric Food Chem, 67 (38), 10604–10613, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)O InChI=1S/C12H20N4O5/c1-7(12(20)21)15-9(17)6-14-11(19)8-3-2-4-16(8)10(18)5-13/h7-8H,2-6,13H2,1H3,(H,14,19)(H,15,17)(H,20,21)/t7-,8-/m0/s1 InChIKey= SMQXQCKNIFGBNY-YUMQZZPRSA-N |
| Database reference: |
| BIOPEP database of sensory peptides and amino acids: ID 241 |