BIOPEP-UWM: Report
| ID | 8658 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 6 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 626.7401 | Monoisotopic mass | 626.3627 | |
| IC50 : | 130.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H., Kabuki T., Seto Y., Serizawa A., Nakajima H. | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-peptidase 4 (DPP-4)-inhibitory peptide LPQNIPPL from gouda-type cheese and its effect on plasma glucose in rats. Int. Dairy J., 22, 24-30, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C29H50N6O9/c1-7-15(4)21(31-24(38)18-10-8-12-34(18)27(41)20(30)14(2)3)26(40)32-22(16(5)36)28(42)35-13-9-11-19(35)25(39)33-23(17(6)37)29(43)44/h14-23,36-37H,7-13,30H2,1-6H3,(H,31,38)(H,32,40)(H,33,39)(H,43,44)/t15-,16+,17+,18-,19-,20-,21-,22-,23-/m0/s1 InChIKey=SJZSLGPYAVBLSF-JRJRRAIFSA-N |
| Database reference: |
| ChemSpider: ID 13164845 EPA DSSTox: ID DTXSID10581198 EROP-Moscow: ID E23833 FeptideDB: ID 8658 MBPDB: Peptide VPITPT PubChem: CID 16036247 |