BIOPEP-UWM: Report
| ID | 8660 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 9 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 965.1411 | Monoisotopic mass | 964.5575 | |
| IC50 : | 1300.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Uenishi H., Kabuki T., Seto Y., Serizawa A., Nakajima H. | |
| Title | |
| Isolation and identification of casein-derived dipeptidyl-peptidase 4 (DPP-4)-inhibitory peptide LPQNIPPL from gouda-type cheese and its effect on plasma glucose in rats. Int. Dairy J., 22, 24-30, 2012 | |
| Year | Source |
| 2012 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C45H76N10O13/c1-9-24(6)33(47)43(65)55-20-12-15-31(55)42(64)53-18-10-13-29(53)39(61)49-28(21-22(2)3)38(60)51-35(25(7)56)41(63)48-27(16-17-32(46)58)37(59)52-36(26(8)57)44(66)54-19-11-14-30(54)40(62)50-34(23(4)5)45(67)68/h22-31,33-36,56-57H,9-21,47H2,1-8H3,(H2,46,58)(H,48,63)(H,49,61)(H,50,62)(H,51,60)(H,52,59)(H,67,68)/t24-,25+,26+,27-,28-,29-,30-,31-,33-,34-,35-,36-/m0/s1 InChIKey=NUUZJLGEZRQVGA-DOCGQKLASA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (I 10099), the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 5953 BIOPEP-UWM database of bioactive peptides: ID 10099 ChemSpider: ID 13163541 EROP-Moscow: ID E07416 FeptideDB: ID 8660 PubChem: CID 16034938 SATPdb: ID satpdb28884 |