BIOPEP-UWM: Report
| ID | 8678 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 332.3536 | Monoisotopic mass | 332.1480 | |
| IC50 : | 120.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derived peptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C16H20N4O4/c17-11(7-9-8-19-12-4-2-1-3-10(9)12)15(22)20-13(16(23)24)5-6-14(18)21/h1-4,8,11,13,19H,5-7,17H2,(H2,18,21)(H,20,22)(H,23,24)/t11-,13-/m0/s1 InChIKey=NZCPCJCJZHKFGZ-AAEUAGOBSA-N Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) according to the BIOPEP-UWM database of bioactive peptides; the ChEMBL database |
| Database reference: |
| AHTPDB: ID 1337, 4151, 4948 BindingDB: ID BDBM50266654 ChEBI: ID 157897 ChEMBL: ID CHEMBL476173 ChemSpider: ID 24697298 DSigDB: ID d4ttd_6061 EROP-Moscow: ID E10609 Metabolomics Workbench: ID 79001 PubChem: CID 25185698 SATPdb: ID satpdb18242 SureChEMBL: ID SCHEMBL5970454 ZINC: ID ZINC000040439750 |