BIOPEP-UWM: Report
| ID | 8680 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 318.3271 | Monoisotopic mass | 318.1324 | |
| IC50 : | 148.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derivedpeptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(=O)N)C(=O)O InChI=1S/C15H18N4O4/c16-10(14(21)19-12(15(22)23)6-13(17)20)5-8-7-18-11-4-2-1-3-9(8)11/h1-4,7,10,12,18H,5-6,16H2,(H2,17,20)(H,19,21)(H,22,23)/t10-,12-/m0/s1 InChIKey=GRQCSEWEPIHLBI-JQWIXIFHSA-N Antagonist of Peroxisome proliferator-activated receptor γ (PPARγ) according to the BIOPEP-UWM database of bioactive peptides; the ChEMBL database |
| Database reference: |
| BindingDB: ID 50266679 BRENDA: Ligand L-tryptophyl-L-asparagine CAS: Registry No 175027-11-9 ChEBI: ID 141447 ChEMBL: ID CHEMBL513911 ChemSpider: ID 5383126 DSigDB: ID d4ttd_6326 EPA CompTox: ID DTXSID901334463 EROP-Moscow: ID E10610 PubChem: CID 7020170 SureChEMBL: ID SCHEMBL21641799 UniChem: ID 256704 Wikidata: ID Q106026419 ZINC: ID ZINC000002561118 |