BIOPEP-UWM: Report
| ID | 8682 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 335.4215 | Monoisotopic mass | 335.1299 | |
| IC50 : | 243.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derived peptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides, 57, 43-51, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[N]([H])C2=CC=CC=C12)C(=O)N[C@@H](CCSC)C(=O)O InChI=1S/C16H21N3O3S/c1-23-7-6-14(16(21)22)19-15(20)12(17)8-10-9-18-13-5-3-2-4-11(10)13/h2-5,9,12,14,18H,6-8,17H2,1H3,(H,19,20)(H,21,22)/t12-,14-/m0/s1 InChIKey: BVZABQIRMYTKCF-JSGCOSHPSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 9090); the BRENDA database; the EROP-Moscow database Inhibitor of Dipeptidyl peptidase-III (DPP-III) (EC 3.4.14.4) (MEROPS ID: M49.001) according to the BIOPEP-UWM database of bioactive peptides (ID 9506) |
| Database reference: |
| AHTPDB: ID 1083, 1466, 2786, 4235, 4727, 5182, 6158 BioPepDB: ID biopep01523 BIOPEP-UWM database of bioactive peptides: ID 9090; 9506 BRENDA: Ligand Trp-Met ChEMBL: ID CHEMBL1221997 ChemSpider: ID 5383129 EPA CompTox: ID DTXSID30427226 EPA DSSTox: ID DTXCID10378060 EROP-Moscow: ID E09198 J-GLOBAL: ID 200907052427309797 Nikkaji: ID J1.941.530I PubChem: CID 7020173 SATPdb: ID satpdb23078 SureChEMBL: ID SCHEMBL2545492 ZINC: ID ZINC02561121 |