BIOPEP-UWM: Report
| ID | 8683 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 367.3976 | Monoisotopic mass | 367.1527 | |
| IC50 : | 281.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derivedpeptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C20H21N3O4/c21-16(10-13-11-22-17-4-2-1-3-15(13)17)19(25)23-18(20(26)27)9-12-5-7-14(24)8-6-12/h1-8,11,16,18,22,24H,9-10,21H2,(H,23,25)(H,26,27)/t16-,18-/m0/s1 InChIKey=TYYLDKGBCJGJGW-WMZOPIPTSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 7898); the DFBP database; the EROP-Moscow database Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides, the DFBP database |
| Database reference: |
| AHTPDB: ID 6963 BindingDB: ID 50188524 BIOPEP-UWM database of bioactive peptides: ID 7898 CAS: Registry No 19653-76-0 ChEBI: ID 74878 ChEMBL: ID CHEMBL39179 ChemSpider ID: 79554 DFBP: ID DFBPACEI0077, DFBPANOX0290, DFBPMUFU0035 EPA CompTox: ID DTXSID90941418 EROP-Moscow: ID E10362 FooDB: ID FDB112099 HMDB: ID HMDB0029095 J-GLOBAL: ID 200907018141468193 Metabolomics Workbench: ID 79014 Nikkaji: ID J151.290K PubChem: CID 88184 SATPdb: ID satpdb10615 Wikidata: ID Q27144988 ZINC: ID ZINC000002384987 |