BIOPEP-UWM: Report
| ID | 8685 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 2 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 305.3283 | Monoisotopic mass | 305.1371 | |
| IC50 : | 482.10 µM |
|||
| Bibliographic data: | |
| Authors | |
| Nongonierma A. B., Mooney C., Shields D. C., FitzGerald R. J. | |
| Title | |
| In silico approaches to predict the potential of milk protein-derived peptides as dipeptidyl peptidase IV (DPP-IV) inhibitors. Peptides 57, 43-51, 2014 | |
| Year | Source |
| 2014 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C15H19N3O4/c1-8(19)13(15(21)22)18-14(20)11(16)6-9-7-17-12-5-3-2-4-10(9)12/h2-5,7-8,11,13,17,19H,6,16H2,1H3,(H,18,20)(H,21,22)/t8-,11+,13+/m1/s1 InChIKey=YBRHKUNWEYBZGT-WLTAIBSBSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides, the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 6932 BRENDA: Ligand WT ChEBI: ID 141450 EROP-Moscow: ID E10414 FooDB: ID FDB11209 HMDB: ID HMDB0029093 J-GLOBAL: ID 200907084709713930 Metabolomics Workbench: ID 79012 Nikkaji: ID J934.697J PMhub: ID MS000241751 PubChem: CID 54499874 SATPdb: ID satpdb23763 SureChEMBL: ID SCHEMBL8525833 UniChem: ID 26688599 Wikidata: Q106026404 ZINC: ID ZINC000040439754 |